C6H7N3O3S2 — CID 175149605
(5-acetamido-1,3,4-thiadiazol-2-yl) 2-sulfanylacetate (PubChem CID 175149605) has the molecular formula C6H7N3O3S2 and a molecular weight of 233.27 g/mol. Its IUPAC name is (5-acetamido-1,3,4-thiadiazol-2-yl) 2-sulfanylacetate.
| Compound Name | (5-acetamido-1,3,4-thiadiazol-2-yl) 2-sulfanylacetate |
|---|---|
| PubChem CID | 175149605 |
| Molecular Formula | C6H7N3O3S2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | (5-acetamido-1,3,4-thiadiazol-2-yl) 2-sulfanylacetate |
| SMILES | CC(=O)Nc1nnc(OC(=O)CS)s1 |
| InChI | InChI=1S/C6H7N3O3S2/c1-3(10)7-5-8-9-6(14-5)12-4(11)2-13/h13H,2H2,1H3,(H,7,8,10) |
| InChIKey | SFKAWWAASICZLE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|