About [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium
[2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium (PubChem CID 175155453) has the molecular formula C10H22BClNO6+
and a molecular weight of 298.55 g/mol. Its IUPAC name is [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium |
| PubChem CID | 175155453 |
| Molecular Formula | C10H22BClNO6+ |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.O=C(OCCl)C(=O)OB(O)O |
| InChI | InChI=1S/C7H18N.C3H4BClO6/c1-5-8(4,6-2)7-3;5-1-10-2(6)3(7)11-4(8)9/h5-7H2,1-4H3;8-9H,1H2/q+1; |
| InChIKey | OXXMCAGZKOKNRB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium?
The IUPAC name of [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium (CID 175155453) is [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium.
What is the SMILES notation for [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium?
The canonical SMILES for [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium is CC[N+](C)(CC)CC.O=C(OCCl)C(=O)OB(O)O.
What is the InChIKey of [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium?
The InChIKey is OXXMCAGZKOKNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.C3H4BClO6/c1-5-8(4,6-2)7-3;5-1-10-2(6)3(7)11-4(8)9/h5-7H2,1-4H3;8-9H,1H2/q+1;.
What are the key properties of [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium?
[2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium has a molecular weight of 298.55 g/mol, XLogP of -0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(chloromethoxy)-2-oxoacetyl]oxyboronic acid;triethyl(methyl)azanium is sourced from PubChem (CID 175155453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).