C26H33F3N4O5 — CID 175161737
3-[3-(carbamoylamino)-4-(3,5-dimethylpiperidin-1-yl)phenyl]-4,4,4-trifluorobutanoic acid;N-(4-hydroxyphenyl)acetamide (PubChem CID 175161737) has the molecular formula C26H33F3N4O5 and a molecular weight of 538.57 g/mol. Its IUPAC name is 3-[3-(carbamoylamino)-4-(3,5-dimethylpiperidin-1-yl)phenyl]-4,4,4-trifluorobutanoic acid;N-(4-hydroxyphenyl)acetamide.
| Compound Name | 3-[3-(carbamoylamino)-4-(3,5-dimethylpiperidin-1-yl)phenyl]-4,4,4-trifluorobutanoic acid;N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 175161737 |
| Molecular Formula | C26H33F3N4O5 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 3-[3-(carbamoylamino)-4-(3,5-dimethylpiperidin-1-yl)phenyl]-4,4,4-trifluorobutanoic acid;N-(4-hydroxyphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(O)cc1.CC1CC(C)CN(c2ccc(C(CC(=O)O)C(F)(F)F)cc2NC(N)=O)C1 |
| InChI | InChI=1S/C18H24F3N3O3.C8H9NO2/c1-10-5-11(2)9-24(8-10)15-4-3-12(6-14(15)23-17(22)27)13(7-16(25)26)18(19,20)21;1-6(10)9-7-2-4-8(11)5-3-7/h3-4,6,10-11,13H,5,7-9H2,1-2H3,(H,25,26)(H3,22,23,27);2-5,11H,1H3,(H,9,10) |
| InChIKey | YFJIAMIGVBIBID-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|