About 4-diazenyloctane-1,8-diamine
4-diazenyloctane-1,8-diamine (PubChem CID 175172672) has the molecular formula C8H20N4
and a molecular weight of 172.28 g/mol. Its IUPAC name is 4-diazenyloctane-1,8-diamine.
Molecular Properties
| Compound Name | 4-diazenyloctane-1,8-diamine |
| PubChem CID | 175172672 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 4-diazenyloctane-1,8-diamine |
| SMILES | [H]/N=N/C(CCCN)CCCCN |
| InChI | InChI=1S/C8H20N4/c9-6-2-1-4-8(12-11)5-3-7-10/h8,11H,1-7,9-10H2/b12-11+ |
| InChIKey | VOUYKZFRGWSDSR-VAWYXSNFSA-N |
| XLogP | 1.25 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenyloctane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenyloctane-1,8-diamine?
The IUPAC name of 4-diazenyloctane-1,8-diamine (CID 175172672) is 4-diazenyloctane-1,8-diamine.
What is the SMILES notation for 4-diazenyloctane-1,8-diamine?
The canonical SMILES for 4-diazenyloctane-1,8-diamine is [H]/N=N/C(CCCN)CCCCN.
What is the InChIKey of 4-diazenyloctane-1,8-diamine?
The InChIKey is VOUYKZFRGWSDSR-VAWYXSNFSA-N. The full InChI is InChI=1S/C8H20N4/c9-6-2-1-4-8(12-11)5-3-7-10/h8,11H,1-7,9-10H2/b12-11+.
What are the key properties of 4-diazenyloctane-1,8-diamine?
4-diazenyloctane-1,8-diamine has a molecular weight of 172.28 g/mol, XLogP of 1.25, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenyloctane-1,8-diamine is sourced from PubChem (CID 175172672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).