C15H34N2O3Si — CID 175178932
5-[3-aminopropyl(diethoxy)silyl]oxy-N,N-dimethylhex-4-en-1-amine (PubChem CID 175178932) has the molecular formula C15H34N2O3Si and a molecular weight of 318.53 g/mol. Its IUPAC name is 5-[3-aminopropyl(diethoxy)silyl]oxy-N,N-dimethylhex-4-en-1-amine.
| Compound Name | 5-[3-aminopropyl(diethoxy)silyl]oxy-N,N-dimethylhex-4-en-1-amine |
|---|---|
| PubChem CID | 175178932 |
| Molecular Formula | C15H34N2O3Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 5-[3-aminopropyl(diethoxy)silyl]oxy-N,N-dimethylhex-4-en-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OC(C)=CCCCN(C)C |
| InChI | InChI=1S/C15H34N2O3Si/c1-6-18-21(19-7-2,14-10-12-16)20-15(3)11-8-9-13-17(4)5/h11H,6-10,12-14,16H2,1-5H3 |
| InChIKey | LEWIQTXBCGUUSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|