C18H19NO9 — CID 175180727
(3R)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 175180727) has the molecular formula C18H19NO9 and a molecular weight of 393.35 g/mol. Its IUPAC name is (3R)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (3R)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 175180727 |
| Molecular Formula | C18H19NO9 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (3R)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC1(C)OC(=O)C(C(=O)[C@@H](CC(=O)O)NC(=O)OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H19NO9/c1-18(2)27-15(23)13(16(24)28-18)14(22)11(8-12(20)21)19-17(25)26-9-10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3,(H,19,25)(H,20,21)/t11-/m1/s1 |
| InChIKey | GEQIUNFVDSMLGK-LLVKDONJSA-N |
| XLogP | 0.78 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|