C21H20FN3O4S — CID 175183640
4-[[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-4-fluorophenyl]methyl]-1,2-dihydrophthalazine-1-carbaldehyde (PubChem CID 175183640) has the molecular formula C21H20FN3O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-[[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-4-fluorophenyl]methyl]-1,2-dihydrophthalazine-1-carbaldehyde.
| Compound Name | 4-[[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-4-fluorophenyl]methyl]-1,2-dihydrophthalazine-1-carbaldehyde |
|---|---|
| PubChem CID | 175183640 |
| Molecular Formula | C21H20FN3O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 4-[[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-4-fluorophenyl]methyl]-1,2-dihydrophthalazine-1-carbaldehyde |
| SMILES | O=CC1NN=C(Cc2ccc(F)c(C(=O)N3CCS(=O)(=O)CC3)c2)c2ccccc21 |
| InChI | InChI=1S/C21H20FN3O4S/c22-18-6-5-14(11-17(18)21(27)25-7-9-30(28,29)10-8-25)12-19-15-3-1-2-4-16(15)20(13-26)24-23-19/h1-6,11,13,20,24H,7-10,12H2 |
| InChIKey | SGOINCUSWJQYMN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|