About ethylidenechromium;pentane-2,4-dione
ethylidenechromium;pentane-2,4-dione (PubChem CID 175183732) has the molecular formula C7H12CrO2
and a molecular weight of 180.17 g/mol. Its IUPAC name is ethylidenechromium;pentane-2,4-dione.
Molecular Properties
| Compound Name | ethylidenechromium;pentane-2,4-dione |
| PubChem CID | 175183732 |
| Molecular Formula | C7H12CrO2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | ethylidenechromium;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CC=[Cr] |
| InChI | InChI=1S/C5H8O2.C2H4.Cr/c1-4(6)3-5(2)7;1-2;/h3H2,1-2H3;1H,2H3; |
| InChIKey | PTSPSGKOVVOFGZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethylidenechromium;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenechromium;pentane-2,4-dione?
The IUPAC name of ethylidenechromium;pentane-2,4-dione (CID 175183732) is ethylidenechromium;pentane-2,4-dione.
What is the SMILES notation for ethylidenechromium;pentane-2,4-dione?
The canonical SMILES for ethylidenechromium;pentane-2,4-dione is CC(=O)CC(C)=O.CC=[Cr].
What is the InChIKey of ethylidenechromium;pentane-2,4-dione?
The InChIKey is PTSPSGKOVVOFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C2H4.Cr/c1-4(6)3-5(2)7;1-2;/h3H2,1-2H3;1H,2H3;.
What are the key properties of ethylidenechromium;pentane-2,4-dione?
ethylidenechromium;pentane-2,4-dione has a molecular weight of 180.17 g/mol, XLogP of 0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenechromium;pentane-2,4-dione is sourced from PubChem (CID 175183732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).