About cyclohepta[b]pyran-2-ol
cyclohepta[b]pyran-2-ol (PubChem CID 175200634) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is cyclohepta[b]pyran-2-ol.
Molecular Properties
| Compound Name | cyclohepta[b]pyran-2-ol |
| PubChem CID | 175200634 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | cyclohepta[b]pyran-2-ol |
| SMILES | OC1=CC=C2C=CC=CC=C2O1 |
| InChI | InChI=1S/C10H8O2/c11-10-7-6-8-4-2-1-3-5-9(8)12-10/h1-7,11H |
| InChIKey | NKTFQMXCLBTLGU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohepta[b]pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[b]pyran-2-ol?
The IUPAC name of cyclohepta[b]pyran-2-ol (CID 175200634) is cyclohepta[b]pyran-2-ol.
What is the SMILES notation for cyclohepta[b]pyran-2-ol?
The canonical SMILES for cyclohepta[b]pyran-2-ol is OC1=CC=C2C=CC=CC=C2O1.
What is the InChIKey of cyclohepta[b]pyran-2-ol?
The InChIKey is NKTFQMXCLBTLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c11-10-7-6-8-4-2-1-3-5-9(8)12-10/h1-7,11H.
What are the key properties of cyclohepta[b]pyran-2-ol?
cyclohepta[b]pyran-2-ol has a molecular weight of 160.17 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[b]pyran-2-ol is sourced from PubChem (CID 175200634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).