C9H17N5 — CID 175210004
(4,6-dipropyl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 175210004) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is (4,6-dipropyl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4,6-dipropyl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 175210004 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | (4,6-dipropyl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | CCCc1nc(CCC)nc(NN)n1 |
| InChI | InChI=1S/C9H17N5/c1-3-5-7-11-8(6-4-2)13-9(12-7)14-10/h3-6,10H2,1-2H3,(H,11,12,13,14) |
| InChIKey | GCPIHKCGBKNNJP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|