C20H20ClN5O3 — CID 175217632
[1-[5-(7-chloro-1,6-naphthyridin-5-yl)-2-pyridinyl]-4-(hydroxymethyl)piperidin-4-yl] carbamate (PubChem CID 175217632) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is [1-[5-(7-chloro-1,6-naphthyridin-5-yl)-2-pyridinyl]-4-(hydroxymethyl)piperidin-4-yl] carbamate.
| Compound Name | [1-[5-(7-chloro-1,6-naphthyridin-5-yl)-2-pyridinyl]-4-(hydroxymethyl)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175217632 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [1-[5-(7-chloro-1,6-naphthyridin-5-yl)-2-pyridinyl]-4-(hydroxymethyl)piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1(CO)CCN(c2ccc(-c3nc(Cl)cc4ncccc34)cn2)CC1 |
| InChI | InChI=1S/C20H20ClN5O3/c21-16-10-15-14(2-1-7-23-15)18(25-16)13-3-4-17(24-11-13)26-8-5-20(12-27,6-9-26)29-19(22)28/h1-4,7,10-11,27H,5-6,8-9,12H2,(H2,22,28) |
| InChIKey | LGSAQOVBPXWEMN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|