About 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile
6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile (PubChem CID 175217932) has the molecular formula C34H26N2O
and a molecular weight of 478.60 g/mol. Its IUPAC name is 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile |
| PubChem CID | 175217932 |
| Molecular Formula | C34H26N2O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(-c2c(C(=O)c3ccccc3)cccc2-c2ccc(C#N)c(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C34H26N2O/c1-22-19-23(2)31(24(3)20-22)32-28(15-10-16-29(32)34(37)26-13-8-5-9-14-26)30-18-17-27(21-35)33(36-30)25-11-6-4-7-12-25/h4-20H,1-3H3 |
| InChIKey | KXDDHAVVVYWZCJ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile?
The IUPAC name of 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile (CID 175217932) is 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile.
What is the SMILES notation for 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile?
The canonical SMILES for 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile is Cc1cc(C)c(-c2c(C(=O)c3ccccc3)cccc2-c2ccc(C#N)c(-c3ccccc3)n2)c(C)c1.
What is the InChIKey of 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile?
The InChIKey is KXDDHAVVVYWZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H26N2O/c1-22-19-23(2)31(24(3)20-22)32-28(15-10-16-29(32)34(37)26-13-8-5-9-14-26)30-18-17-27(21-35)33(36-30)25-11-6-4-7-12-25/h4-20H,1-3H3.
What are the key properties of 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile?
6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile has a molecular weight of 478.60 g/mol, XLogP of 8.11, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-benzoyl-2-(2,4,6-trimethylphenyl)phenyl]-2-phenylpyridine-3-carbonitrile is sourced from PubChem (CID 175217932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).