About (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione
(6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione (PubChem CID 175218193) has the molecular formula C6H5ClO4
and a molecular weight of 176.56 g/mol. Its IUPAC name is (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione.
Analyze (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione?
The IUPAC name of (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione (CID 175218193) is (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione.
What is the SMILES notation for (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione?
The canonical SMILES for (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione is O=C1/C=C(/Cl)C(=O)OCCO1.
What is the InChIKey of (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione?
The InChIKey is NJJVSYNWJMREDU-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H5ClO4/c7-4-3-5(8)10-1-2-11-6(4)9/h3H,1-2H2/b4-3+.
What are the key properties of (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione?
(6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione has a molecular weight of 176.56 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-chloro-2,3-dihydro-1,4-dioxocine-5,8-dione is sourced from PubChem (CID 175218193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).