About dipentoxymethoxysilane
dipentoxymethoxysilane (PubChem CID 175221676) has the molecular formula C11H26O3Si
and a molecular weight of 234.41 g/mol. Its IUPAC name is dipentoxymethoxysilane.
Molecular Properties
| Compound Name | dipentoxymethoxysilane |
| PubChem CID | 175221676 |
| Molecular Formula | C11H26O3Si |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | dipentoxymethoxysilane |
| SMILES | CCCCCOC(O[SiH3])OCCCCC |
| InChI | InChI=1S/C11H26O3Si/c1-3-5-7-9-12-11(14-15)13-10-8-6-4-2/h11H,3-10H2,1-2,15H3 |
| InChIKey | ZTGHWACLYLUORO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dipentoxymethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipentoxymethoxysilane?
The IUPAC name of dipentoxymethoxysilane (CID 175221676) is dipentoxymethoxysilane.
What is the SMILES notation for dipentoxymethoxysilane?
The canonical SMILES for dipentoxymethoxysilane is CCCCCOC(O[SiH3])OCCCCC.
What is the InChIKey of dipentoxymethoxysilane?
The InChIKey is ZTGHWACLYLUORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O3Si/c1-3-5-7-9-12-11(14-15)13-10-8-6-4-2/h11H,3-10H2,1-2,15H3.
What are the key properties of dipentoxymethoxysilane?
dipentoxymethoxysilane has a molecular weight of 234.41 g/mol, XLogP of 1.98, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipentoxymethoxysilane is sourced from PubChem (CID 175221676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).