C5H5ClN2S2 — CID 175238502
5-chloro-3-prop-2-enyl-1-sulfanylidene-1,2,4-thiadiazole (PubChem CID 175238502) has the molecular formula C5H5ClN2S2 and a molecular weight of 192.70 g/mol. Its IUPAC name is 5-chloro-3-prop-2-enyl-1-sulfanylidene-1,2,4-thiadiazole.
| Compound Name | 5-chloro-3-prop-2-enyl-1-sulfanylidene-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 175238502 |
| Molecular Formula | C5H5ClN2S2 |
| Molecular Weight | 192.70 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | 5-chloro-3-prop-2-enyl-1-sulfanylidene-1,2,4-thiadiazole |
| SMILES | C=CCC1=NS(=S)C(Cl)=N1 |
| InChI | InChI=1S/C5H5ClN2S2/c1-2-3-4-7-5(6)10(9)8-4/h2H,1,3H2 |
| InChIKey | PQVVQAHDOCLHTI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|