C21H20BrN3O6S — CID 175239036
2-[(4aR,6R,7R,8aR)-8-azido-7-methoxy-2-phenyl-6-sulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-4-bromobenzoic acid (PubChem CID 175239036) has the molecular formula C21H20BrN3O6S and a molecular weight of 522.38 g/mol. Its IUPAC name is 2-[(4aR,6R,7R,8aR)-8-azido-7-methoxy-2-phenyl-6-sulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-4-bromobenzoic acid.
| Compound Name | 2-[(4aR,6R,7R,8aR)-8-azido-7-methoxy-2-phenyl-6-sulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-4-bromobenzoic acid |
|---|---|
| PubChem CID | 175239036 |
| Molecular Formula | C21H20BrN3O6S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 2-[(4aR,6R,7R,8aR)-8-azido-7-methoxy-2-phenyl-6-sulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-4-bromobenzoic acid |
| SMILES | CO[C@H]1[C@@H](S)O[C@@H]2COC(c3ccccc3)O[C@@H]2C1(N=[N+]=[N-])c1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C21H20BrN3O6S/c1-28-17-20(32)30-15-10-29-19(11-5-3-2-4-6-11)31-16(15)21(17,24-25-23)14-9-12(22)7-8-13(14)18(26)27/h2-9,15-17,19-20,32H,10H2,1H3,(H,26,27)/t15-,16+,17+,19?,20-,21?/m1/s1 |
| InChIKey | ONBZBOKPYLBRBV-OBSDDKGFSA-N |
| XLogP | 4.44 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|