About molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane
molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane (PubChem CID 175239938) has the molecular formula C15H36Al2
and a molecular weight of 270.42 g/mol. Its IUPAC name is molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane.
Molecular Properties
| Compound Name | molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane |
| PubChem CID | 175239938 |
| Molecular Formula | C15H36Al2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane |
| SMILES | C=CC[AlH2].CC(C)C[Al](CC(C)C)CC(C)C.[H][H] |
| InChI | InChI=1S/3C4H9.C3H5.2Al.H2.2H/c3*1-4(2)3;1-3-2;;;;;/h3*4H,1H2,2-3H3;3H,1-2H2;;;1H;; |
| InChIKey | QLNPWMJWJOPRIN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane?
The IUPAC name of molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane (CID 175239938) is molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane.
What is the SMILES notation for molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane?
The canonical SMILES for molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane is C=CC[AlH2].CC(C)C[Al](CC(C)C)CC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane?
The InChIKey is QLNPWMJWJOPRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H5.2Al.H2.2H/c3*1-4(2)3;1-3-2;;;;;/h3*4H,1H2,2-3H3;3H,1-2H2;;;1H;;.
What are the key properties of molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane?
molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane has a molecular weight of 270.42 g/mol, XLogP of 4.92, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;prop-2-enylalumane;tris(2-methylpropyl)alumane is sourced from PubChem (CID 175239938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).