C19H22ClN3O5 — CID 175247455
3-[2-[(3-acetyloxy-7-chloro-1-cyclopropyl-4-oxoquinolin-6-yl)amino]ethylamino]propanoic acid (PubChem CID 175247455) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is 3-[2-[(3-acetyloxy-7-chloro-1-cyclopropyl-4-oxoquinolin-6-yl)amino]ethylamino]propanoic acid.
| Compound Name | 3-[2-[(3-acetyloxy-7-chloro-1-cyclopropyl-4-oxoquinolin-6-yl)amino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 175247455 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[2-[(3-acetyloxy-7-chloro-1-cyclopropyl-4-oxoquinolin-6-yl)amino]ethylamino]propanoic acid |
| SMILES | CC(=O)Oc1cn(C2CC2)c2cc(Cl)c(NCCNCCC(=O)O)cc2c1=O |
| InChI | InChI=1S/C19H22ClN3O5/c1-11(24)28-17-10-23(12-2-3-12)16-9-14(20)15(8-13(16)19(17)27)22-7-6-21-5-4-18(25)26/h8-10,12,21-22H,2-7H2,1H3,(H,25,26) |
| InChIKey | SDEMTTBQHDNDTJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|