C33H41F3O8 — CID 175250145
butyl 2-methylprop-2-enoate;2-methyl-3-[5,5,5-trifluoro-2-methyl-3-(2-methyl-5-phenylpenta-2,4-dienoyl)oxypent-2-enoyl]oxyhex-2-enoic acid (PubChem CID 175250145) has the molecular formula C33H41F3O8 and a molecular weight of 622.68 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-methyl-3-[5,5,5-trifluoro-2-methyl-3-(2-methyl-5-phenylpenta-2,4-dienoyl)oxypent-2-enoyl]oxyhex-2-enoic acid.
| Compound Name | butyl 2-methylprop-2-enoate;2-methyl-3-[5,5,5-trifluoro-2-methyl-3-(2-methyl-5-phenylpenta-2,4-dienoyl)oxypent-2-enoyl]oxyhex-2-enoic acid |
|---|---|
| PubChem CID | 175250145 |
| Molecular Formula | C33H41F3O8 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-methyl-3-[5,5,5-trifluoro-2-methyl-3-(2-methyl-5-phenylpenta-2,4-dienoyl)oxypent-2-enoyl]oxyhex-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCCC.CCCC(OC(=O)C(C)=C(CC(F)(F)F)OC(=O)C(C)=CC=Cc1ccccc1)=C(C)C(=O)O |
| InChI | InChI=1S/C25H27F3O6.C8H14O2/c1-5-10-20(17(3)22(29)30)33-24(32)18(4)21(15-25(26,27)28)34-23(31)16(2)11-9-14-19-12-7-6-8-13-19;1-4-5-6-10-8(9)7(2)3/h6-9,11-14H,5,10,15H2,1-4H3,(H,29,30);2,4-6H2,1,3H3 |
| InChIKey | MAKYGGHTJZVTOT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|