C25H32N8O2 — CID 175250346
5-[[6-[(4-butanimidoylpiperidine-1-carbonyl)amino]pyrimidin-4-yl]amino]-N-ethylindole-1-carboxamide (PubChem CID 175250346) has the molecular formula C25H32N8O2 and a molecular weight of 476.59 g/mol. Its IUPAC name is 5-[[6-[(4-butanimidoylpiperidine-1-carbonyl)amino]pyrimidin-4-yl]amino]-N-ethylindole-1-carboxamide.
| Compound Name | 5-[[6-[(4-butanimidoylpiperidine-1-carbonyl)amino]pyrimidin-4-yl]amino]-N-ethylindole-1-carboxamide |
|---|---|
| PubChem CID | 175250346 |
| Molecular Formula | C25H32N8O2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 5-[[6-[(4-butanimidoylpiperidine-1-carbonyl)amino]pyrimidin-4-yl]amino]-N-ethylindole-1-carboxamide |
| SMILES | [H]/N=C(\CCC)C1CCN(C(=O)Nc2cc(Nc3ccc4c(ccn4C(=O)NCC)c3)ncn2)CC1 |
| InChI | InChI=1S/C25H32N8O2/c1-3-5-20(26)17-8-11-32(12-9-17)25(35)31-23-15-22(28-16-29-23)30-19-6-7-21-18(14-19)10-13-33(21)24(34)27-4-2/h6-7,10,13-17,26H,3-5,8-9,11-12H2,1-2H3,(H,27,34)(H2,28,29,30,31,35)/b26-20+ |
| InChIKey | LPIAMMMKVNZGFO-LHLOQNFPSA-N |
| XLogP | 4.82 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|