C23H31N7O2 — CID 58792219
6-[[6-[5-(diethylamino)pentanoylamino]pyrimidin-4-yl]amino]-N-methylindole-1-carboxamide (PubChem CID 58792219) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 6-[[6-[5-(diethylamino)pentanoylamino]pyrimidin-4-yl]amino]-N-methylindole-1-carboxamide.
| Compound Name | 6-[[6-[5-(diethylamino)pentanoylamino]pyrimidin-4-yl]amino]-N-methylindole-1-carboxamide |
|---|---|
| PubChem CID | 58792219 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 6-[[6-[5-(diethylamino)pentanoylamino]pyrimidin-4-yl]amino]-N-methylindole-1-carboxamide |
| SMILES | CCN(CC)CCCCC(=O)Nc1cc(Nc2ccc3ccn(C(=O)NC)c3c2)ncn1 |
| InChI | InChI=1S/C23H31N7O2/c1-4-29(5-2)12-7-6-8-22(31)28-21-15-20(25-16-26-21)27-18-10-9-17-11-13-30(19(17)14-18)23(32)24-3/h9-11,13-16H,4-8,12H2,1-3H3,(H,24,32)(H2,25,26,27,28,31) |
| InChIKey | FFAUYAGXSCWTQF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|