C8H16O4Si — CID 175251380
silyl 4,4-dimethoxy-2,3-dimethylbut-2-enoate (PubChem CID 175251380) has the molecular formula C8H16O4Si and a molecular weight of 204.30 g/mol. Its IUPAC name is silyl 4,4-dimethoxy-2,3-dimethylbut-2-enoate.
| Compound Name | silyl 4,4-dimethoxy-2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 175251380 |
| Molecular Formula | C8H16O4Si |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | silyl 4,4-dimethoxy-2,3-dimethylbut-2-enoate |
| SMILES | COC(OC)C(C)=C(C)C(=O)O[SiH3] |
| InChI | InChI=1S/C8H16O4Si/c1-5(7(9)12-13)6(2)8(10-3)11-4/h8H,1-4,13H3 |
| InChIKey | UBRUVVNUCIDOTK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|