C14H11F3O2 — CID 175253078
2-[(2,3-difluoro-4-methoxyphenyl)-fluoromethyl]phenol (PubChem CID 175253078) has the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[(2,3-difluoro-4-methoxyphenyl)-fluoromethyl]phenol.
| Compound Name | 2-[(2,3-difluoro-4-methoxyphenyl)-fluoromethyl]phenol |
|---|---|
| PubChem CID | 175253078 |
| Molecular Formula | C14H11F3O2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(2,3-difluoro-4-methoxyphenyl)-fluoromethyl]phenol |
| SMILES | COc1ccc(C(F)c2ccccc2O)c(F)c1F |
| InChI | InChI=1S/C14H11F3O2/c1-19-11-7-6-9(13(16)14(11)17)12(15)8-4-2-3-5-10(8)18/h2-7,12,18H,1H3 |
| InChIKey | VLNAZCHKBHHLKV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |