C16H31NO6 — CID 175254714
acetic acid;1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one (PubChem CID 175254714) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is acetic acid;1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one.
| Compound Name | acetic acid;1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one |
|---|---|
| PubChem CID | 175254714 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | acetic acid;1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one |
| SMILES | CC(=O)O.CCC(=O)CC(O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H27NO4.C2H4O2/c1-6-10(16)7-12(17)19-11-8-13(2,3)15(18)14(4,5)9-11;1-2(3)4/h11-12,17-18H,6-9H2,1-5H3;1H3,(H,3,4) |
| InChIKey | AZXSDKPESOBVFO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|