C14H27NO4 — CID 175254715
1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one (PubChem CID 175254715) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is 1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one.
| Compound Name | 1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one |
|---|---|
| PubChem CID | 175254715 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 1-hydroxy-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentan-3-one |
| SMILES | CCC(=O)CC(O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H27NO4/c1-6-10(16)7-12(17)19-11-8-13(2,3)15(18)14(4,5)9-11/h11-12,17-18H,6-9H2,1-5H3 |
| InChIKey | SXHJWKVGUTVGEU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|