C18H26N4 — CID 175274016
N-(3,5-ditert-butylphenyl)-4-methyl-1,3,5-triazin-2-amine (PubChem CID 175274016) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-(3,5-ditert-butylphenyl)-4-methyl-1,3,5-triazin-2-amine.
| Compound Name | N-(3,5-ditert-butylphenyl)-4-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175274016 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-(3,5-ditert-butylphenyl)-4-methyl-1,3,5-triazin-2-amine |
| SMILES | Cc1ncnc(Nc2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C18H26N4/c1-12-19-11-20-16(21-12)22-15-9-13(17(2,3)4)8-14(10-15)18(5,6)7/h8-11H,1-7H3,(H,19,20,21,22) |
| InChIKey | IBSAXVDXVQXFBP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |