C20H20Hf — CID 175279082
3-benzyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene;hafnium (PubChem CID 175279082) has the molecular formula C20H20Hf and a molecular weight of 438.87 g/mol. Its IUPAC name is 3-benzyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene;hafnium.
| Compound Name | 3-benzyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene;hafnium |
|---|---|
| PubChem CID | 175279082 |
| Molecular Formula | C20H20Hf |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-benzyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene;hafnium |
| SMILES | C1=CC(Cc2ccccc2)c2cc3c(cc21)CCCC3.[Hf] |
| InChI | InChI=1S/C20H20.Hf/c1-2-6-15(7-3-1)12-18-10-11-19-13-16-8-4-5-9-17(16)14-20(18)19;/h1-3,6-7,10-11,13-14,18H,4-5,8-9,12H2; |
| InChIKey | WVODMDQHENCQQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |