C19H18Hf — CID 175279096
5-benzyl-1,2,3,5-tetrahydro-s-indacene;hafnium (PubChem CID 175279096) has the molecular formula C19H18Hf and a molecular weight of 424.84 g/mol. Its IUPAC name is 5-benzyl-1,2,3,5-tetrahydro-s-indacene;hafnium.
| Compound Name | 5-benzyl-1,2,3,5-tetrahydro-s-indacene;hafnium |
|---|---|
| PubChem CID | 175279096 |
| Molecular Formula | C19H18Hf |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 5-benzyl-1,2,3,5-tetrahydro-s-indacene;hafnium |
| SMILES | C1=CC(Cc2ccccc2)c2cc3c(cc21)CCC3.[Hf] |
| InChI | InChI=1S/C19H18.Hf/c1-2-5-14(6-3-1)11-17-9-10-18-12-15-7-4-8-16(15)13-19(17)18;/h1-3,5-6,9-10,12-13,17H,4,7-8,11H2; |
| InChIKey | ZRQLRVIYQMHWAY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |