C14H20O10P2 — CID 175289306
3-(2,6-dimethylphenoxy)phenol;phosphoric acid (PubChem CID 175289306) has the molecular formula C14H20O10P2 and a molecular weight of 410.25 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)phenol;phosphoric acid.
| Compound Name | 3-(2,6-dimethylphenoxy)phenol;phosphoric acid |
|---|---|
| PubChem CID | 175289306 |
| Molecular Formula | C14H20O10P2 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 3-(2,6-dimethylphenoxy)phenol;phosphoric acid |
| SMILES | Cc1cccc(C)c1Oc1cccc(O)c1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C14H14O2.2H3O4P/c1-10-5-3-6-11(2)14(10)16-13-8-4-7-12(15)9-13;2*1-5(2,3)4/h3-9,15H,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | AVPMCMQDFMMNBY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|