C24H36Br2N2O3 — CID 175291081
butyl 1,3-bis(4-bromobutyl)-2-hydroxy-6-methyl-4-phenyl-2,4-dihydropyrimidine-5-carboxylate (PubChem CID 175291081) has the molecular formula C24H36Br2N2O3 and a molecular weight of 560.37 g/mol. Its IUPAC name is butyl 1,3-bis(4-bromobutyl)-2-hydroxy-6-methyl-4-phenyl-2,4-dihydropyrimidine-5-carboxylate.
| Compound Name | butyl 1,3-bis(4-bromobutyl)-2-hydroxy-6-methyl-4-phenyl-2,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 175291081 |
| Molecular Formula | C24H36Br2N2O3 |
| Molecular Weight | 560.37 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | butyl 1,3-bis(4-bromobutyl)-2-hydroxy-6-methyl-4-phenyl-2,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)N(CCCCBr)C(O)N(CCCCBr)C1c1ccccc1 |
| InChI | InChI=1S/C24H36Br2N2O3/c1-3-4-18-31-23(29)21-19(2)27(16-10-8-14-25)24(30)28(17-11-9-15-26)22(21)20-12-6-5-7-13-20/h5-7,12-13,22,24,30H,3-4,8-11,14-18H2,1-2H3 |
| InChIKey | TWZHFBRKLLHLGI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|