C22H22N2O2 — CID 175303389
(4-cyclohexyl-3,5-diphenylpyrazol-1-yl) formate (PubChem CID 175303389) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (4-cyclohexyl-3,5-diphenylpyrazol-1-yl) formate.
| Compound Name | (4-cyclohexyl-3,5-diphenylpyrazol-1-yl) formate |
|---|---|
| PubChem CID | 175303389 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4-cyclohexyl-3,5-diphenylpyrazol-1-yl) formate |
| SMILES | O=COn1nc(-c2ccccc2)c(C2CCCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-16-26-24-22(19-14-8-3-9-15-19)20(17-10-4-1-5-11-17)21(23-24)18-12-6-2-7-13-18/h2-3,6-9,12-17H,1,4-5,10-11H2 |
| InChIKey | ASXMDQIWSQXZTN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|