C18H22N2O4 — CID 175316241
4-(aminomethyl)-N-ethylaniline;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 175316241) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-ethylaniline;2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(aminomethyl)-N-ethylaniline;2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175316241 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-(aminomethyl)-N-ethylaniline;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | CCNc1ccc(CN)cc1.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H14N2.C9H8O4/c1-2-11-9-5-3-8(7-10)4-6-9;1-5-6(8(10)11)3-2-4-7(5)9(12)13/h3-6,11H,2,7,10H2,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | NACUKMCGJBGMLG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |