C24H25F3NO5S- — CID 175316859
CID 175316859 (PubChem CID 175316859) has the molecular formula C24H25F3NO5S- and a molecular weight of 496.53 g/mol.
| Compound Name | CID 175316859 |
|---|---|
| PubChem CID | 175316859 |
| Molecular Formula | C24H25F3NO5S- |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | — |
| SMILES | COc1ccc(Cc2cccc(C(O)C(F)(F)F)c2Cc2ccc(OC)cc2)cc1.NS(=O)[O-] |
| InChI | InChI=1S/C24H23F3O3.H3NO2S/c1-29-19-10-6-16(7-11-19)14-18-4-3-5-21(23(28)24(25,26)27)22(18)15-17-8-12-20(30-2)13-9-17;1-4(2)3/h3-13,23,28H,14-15H2,1-2H3;1H2,(H,2,3)/p-1 |
| InChIKey | HKHPLVSEASXCQO-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|