C9H21NO5P+ — CID 175331482
2-but-2-ynoxyethyl(trimethyl)azanium;phosphoric acid (PubChem CID 175331482) has the molecular formula C9H21NO5P+ and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-but-2-ynoxyethyl(trimethyl)azanium;phosphoric acid.
| Compound Name | 2-but-2-ynoxyethyl(trimethyl)azanium;phosphoric acid |
|---|---|
| PubChem CID | 175331482 |
| Molecular Formula | C9H21NO5P+ |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-but-2-ynoxyethyl(trimethyl)azanium;phosphoric acid |
| SMILES | CC#CCOCC[N+](C)(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C9H18NO.H3O4P/c1-5-6-8-11-9-7-10(2,3)4;1-5(2,3)4/h7-9H2,1-4H3;(H3,1,2,3,4)/q+1; |
| InChIKey | FBEHNQVMWMCKJC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|