C12H10N2O3S — CID 175336152
2-(1,3-benzothiazol-2-yl)prop-2-enoic acid;methylimino(oxo)methane (PubChem CID 175336152) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)prop-2-enoic acid;methylimino(oxo)methane.
| Compound Name | 2-(1,3-benzothiazol-2-yl)prop-2-enoic acid;methylimino(oxo)methane |
|---|---|
| PubChem CID | 175336152 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)prop-2-enoic acid;methylimino(oxo)methane |
| SMILES | C=C(C(=O)O)c1nc2ccccc2s1.CN=C=O |
| InChI | InChI=1S/C10H7NO2S.C2H3NO/c1-6(10(12)13)9-11-7-4-2-3-5-8(7)14-9;1-3-2-4/h2-5H,1H2,(H,12,13);1H3 |
| InChIKey | FGZIOVORUJEEQN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|