C31H24BrF3N2O5 — CID 175336370
4,5-dihydroxy-9,10-dioxo-N-[3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]propyl]anthracene-2-carboxamide bromide (PubChem CID 175336370) has the molecular formula C31H24BrF3N2O5 and a molecular weight of 641.44 g/mol. Its IUPAC name is 4,5-dihydroxy-9,10-dioxo-N-[3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]propyl]anthracene-2-carboxamide bromide.
| Compound Name | 4,5-dihydroxy-9,10-dioxo-N-[3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]propyl]anthracene-2-carboxamide bromide |
|---|---|
| PubChem CID | 175336370 |
| Molecular Formula | C31H24BrF3N2O5 |
| Molecular Weight | 641.44 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | 4,5-dihydroxy-9,10-dioxo-N-[3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]propyl]anthracene-2-carboxamide bromide |
| SMILES | O=C(NCCCc1cc[n+](Cc2ccc(C(F)(F)F)cc2)cc1)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[Br-] |
| InChI | InChI=1S/C31H23F3N2O5.BrH/c32-31(33,34)21-8-6-19(7-9-21)17-36-13-10-18(11-14-36)3-2-12-35-30(41)20-15-23-27(25(38)16-20)29(40)26-22(28(23)39)4-1-5-24(26)37;/h1,4-11,13-16H,2-3,12,17H2,(H2-,35,37,38,40,41);1H |
| InChIKey | QROJTKWXZADRTI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|