C11H22Br2N2O — CID 175345055
2-(2-aminoethyl)-2,8-dibromononanamide (PubChem CID 175345055) has the molecular formula C11H22Br2N2O and a molecular weight of 358.12 g/mol. Its IUPAC name is 2-(2-aminoethyl)-2,8-dibromononanamide.
| Compound Name | 2-(2-aminoethyl)-2,8-dibromononanamide |
|---|---|
| PubChem CID | 175345055 |
| Molecular Formula | C11H22Br2N2O |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(2-aminoethyl)-2,8-dibromononanamide |
| SMILES | CC(Br)CCCCCC(Br)(CCN)C(N)=O |
| InChI | InChI=1S/C11H22Br2N2O/c1-9(12)5-3-2-4-6-11(13,7-8-14)10(15)16/h9H,2-8,14H2,1H3,(H2,15,16) |
| InChIKey | OXNUVUVGAFAQNM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|