C10H10N2O4S — CID 175360764
azetidin-2-one;1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 175360764) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is azetidin-2-one;1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | azetidin-2-one;1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 175360764 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | azetidin-2-one;1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1CCN1.O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C7H5NO3S.C3H5NO/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;5-3-1-2-4-3/h1-4H,(H,8,9);1-2H2,(H,4,5) |
| InChIKey | YZOJDQKMPIOYON-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |