C16H24O7 — CID 175363961
2-[1-(4-methyl-3-oxopent-4-enoxy)ethylperoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 175363961) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[1-(4-methyl-3-oxopent-4-enoxy)ethylperoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[1-(4-methyl-3-oxopent-4-enoxy)ethylperoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 175363961 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[1-(4-methyl-3-oxopent-4-enoxy)ethylperoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | C=C(C)C(=O)CCOC(C)OOC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C16H24O7/c1-10(2)14(17)8-9-21-11(3)22-23-16(20)13-7-5-4-6-12(13)15(18)19/h11-13H,1,4-9H2,2-3H3,(H,18,19) |
| InChIKey | ZDQBTTXKEDDKPH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|