About thieno[3,2-c]pyridin-7-yl acetate
thieno[3,2-c]pyridin-7-yl acetate (PubChem CID 175378782) has the molecular formula C9H7NO2S
and a molecular weight of 193.23 g/mol. Its IUPAC name is thieno[3,2-c]pyridin-7-yl acetate.
Molecular Properties
| Compound Name | thieno[3,2-c]pyridin-7-yl acetate |
| PubChem CID | 175378782 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | thieno[3,2-c]pyridin-7-yl acetate |
| SMILES | CC(=O)Oc1cncc2ccsc12 |
| InChI | InChI=1S/C9H7NO2S/c1-6(11)12-8-5-10-4-7-2-3-13-9(7)8/h2-5H,1H3 |
| InChIKey | AZAQVXUVIABZLF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[3,2-c]pyridin-7-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-c]pyridin-7-yl acetate?
The IUPAC name of thieno[3,2-c]pyridin-7-yl acetate (CID 175378782) is thieno[3,2-c]pyridin-7-yl acetate.
What is the SMILES notation for thieno[3,2-c]pyridin-7-yl acetate?
The canonical SMILES for thieno[3,2-c]pyridin-7-yl acetate is CC(=O)Oc1cncc2ccsc12.
What is the InChIKey of thieno[3,2-c]pyridin-7-yl acetate?
The InChIKey is AZAQVXUVIABZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S/c1-6(11)12-8-5-10-4-7-2-3-13-9(7)8/h2-5H,1H3.
What are the key properties of thieno[3,2-c]pyridin-7-yl acetate?
thieno[3,2-c]pyridin-7-yl acetate has a molecular weight of 193.23 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-c]pyridin-7-yl acetate is sourced from PubChem (CID 175378782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).