C27H42N2O5S — CID 175385867
(3R)-1-[3-[6-methyl-5-(2-methylphenyl)-1-[3-(2-methylsulfonylethylamino)propoxy]cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol (PubChem CID 175385867) has the molecular formula C27H42N2O5S and a molecular weight of 506.71 g/mol. Its IUPAC name is (3R)-1-[3-[6-methyl-5-(2-methylphenyl)-1-[3-(2-methylsulfonylethylamino)propoxy]cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[6-methyl-5-(2-methylphenyl)-1-[3-(2-methylsulfonylethylamino)propoxy]cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 175385867 |
| Molecular Formula | C27H42N2O5S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | (3R)-1-[3-[6-methyl-5-(2-methylphenyl)-1-[3-(2-methylsulfonylethylamino)propoxy]cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
| SMILES | Cc1ccccc1C1=CC=CC(OCCCNCCS(C)(=O)=O)(OCCCN2CC[C@@H](O)C2)C1C |
| InChI | InChI=1S/C27H42N2O5S/c1-22-9-4-5-10-25(22)26-11-6-13-27(23(26)2,33-18-7-14-28-15-20-35(3,31)32)34-19-8-16-29-17-12-24(30)21-29/h4-6,9-11,13,23-24,28,30H,7-8,12,14-21H2,1-3H3/t23?,24-,27?/m1/s1 |
| InChIKey | VWFIZLGKCYDFLQ-BPLQSXGDSA-N |
| XLogP | 2.79 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|