C35H49N3O4 — CID 175385957
(3R)-1-[3-[1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol (PubChem CID 175385957) has the molecular formula C35H49N3O4 and a molecular weight of 575.79 g/mol. Its IUPAC name is (3R)-1-[3-[1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 175385957 |
| Molecular Formula | C35H49N3O4 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | (3R)-1-[3-[1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
| SMILES | COc1ccccc1N1CCN(CCCOC2(OCCCN3CC[C@@H](O)C3)C=CC=C(c3ccccc3C)C2C)CC1 |
| InChI | InChI=1S/C35H49N3O4/c1-28-11-4-5-12-31(28)32-13-8-17-35(29(32)2,42-26-10-19-37-20-16-30(39)27-37)41-25-9-18-36-21-23-38(24-22-36)33-14-6-7-15-34(33)40-3/h4-8,11-15,17,29-30,39H,9-10,16,18-27H2,1-3H3/t29?,30-,35?/m1/s1 |
| InChIKey | MWLRRRXXJDIHOJ-WABZKNDASA-N |
| XLogP | 4.99 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|