C29H46N2O4 — CID 175385857
(3R)-1-[3-[1-[3-[(1-hydroxy-3-methylbutan-2-yl)amino]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol (PubChem CID 175385857) has the molecular formula C29H46N2O4 and a molecular weight of 486.70 g/mol. Its IUPAC name is (3R)-1-[3-[1-[3-[(1-hydroxy-3-methylbutan-2-yl)amino]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[1-[3-[(1-hydroxy-3-methylbutan-2-yl)amino]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 175385857 |
| Molecular Formula | C29H46N2O4 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | (3R)-1-[3-[1-[3-[(1-hydroxy-3-methylbutan-2-yl)amino]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
| SMILES | Cc1ccccc1C1=CC=CC(OCCCNC(CO)C(C)C)(OCCCN2CC[C@@H](O)C2)C1C |
| InChI | InChI=1S/C29H46N2O4/c1-22(2)28(21-32)30-15-8-18-34-29(35-19-9-16-31-17-13-25(33)20-31)14-7-12-27(24(29)4)26-11-6-5-10-23(26)3/h5-7,10-12,14,22,24-25,28,30,32-33H,8-9,13,15-21H2,1-4H3/t24?,25-,28?,29?/m1/s1 |
| InChIKey | WGFUFTMBFMVTFO-OEKAEXPJSA-N |
| XLogP | 3.77 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|