C21H23FN6O3 — CID 175394491
N-[[3-[4-[4-[(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 175394491) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[[3-[4-[4-[(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-[(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 175394491 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[[3-[4-[4-[(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-c3ccc(C=NN=C(N)N)cc3)c(F)c2C)C(=O)O1 |
| InChI | InChI=1S/C21H23FN6O3/c1-12-18(28-11-16(31-21(28)30)10-25-13(2)29)8-7-17(19(12)22)15-5-3-14(4-6-15)9-26-27-20(23)24/h3-9,16H,10-11H2,1-2H3,(H,25,29)(H4,23,24,27) |
| InChIKey | BEVRPNBUMIXRPG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|