C21H22FN5O3S — CID 175394551
N-[[3-[4-[4-[(carbamothioylhydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 175394551) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[[3-[4-[4-[(carbamothioylhydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-[(carbamothioylhydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 175394551 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[[3-[4-[4-[(carbamothioylhydrazinylidene)methyl]phenyl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-c3ccc(C=NNC(N)=S)cc3)c(F)c2C)C(=O)O1 |
| InChI | InChI=1S/C21H22FN5O3S/c1-12-18(27-11-16(30-21(27)29)10-24-13(2)28)8-7-17(19(12)22)15-5-3-14(4-6-15)9-25-26-20(23)31/h3-9,16H,10-11H2,1-2H3,(H,24,28)(H3,23,26,31) |
| InChIKey | XHRQOSCFBOUSLH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|