C8H15F3OSi — CID 175394815
6-methyloxasilinane;1,1,2-trifluorocyclopropane (PubChem CID 175394815) has the molecular formula C8H15F3OSi and a molecular weight of 212.29 g/mol. Its IUPAC name is 6-methyloxasilinane;1,1,2-trifluorocyclopropane.
| Compound Name | 6-methyloxasilinane;1,1,2-trifluorocyclopropane |
|---|---|
| PubChem CID | 175394815 |
| Molecular Formula | C8H15F3OSi |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 6-methyloxasilinane;1,1,2-trifluorocyclopropane |
| SMILES | CC1CCC[SiH2]O1.FC1CC1(F)F |
| InChI | InChI=1S/C5H12OSi.C3H3F3/c1-5-3-2-4-7-6-5;4-2-1-3(2,5)6/h5H,2-4,7H2,1H3;2H,1H2 |
| InChIKey | RAPSZVNNYNGYPO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|