C15H10F19NO2S — CID 175438743
ethyl 2-methylprop-2-enoate;N,2,2,3,3,3-hexafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)propanethioamide (PubChem CID 175438743) has the molecular formula C15H10F19NO2S and a molecular weight of 629.28 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;N,2,2,3,3,3-hexafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)propanethioamide.
| Compound Name | ethyl 2-methylprop-2-enoate;N,2,2,3,3,3-hexafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)propanethioamide |
|---|---|
| PubChem CID | 175438743 |
| Molecular Formula | C15H10F19NO2S |
| Molecular Weight | 629.28 g/mol |
| Exact Mass | 629.01 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;N,2,2,3,3,3-hexafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)propanethioamide |
| SMILES | C=C(C)C(=O)OCC.FN(C(=S)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F19NS.C6H10O2/c10-2(11,7(20,21)22)1(30)29(28)9(26,27)6(18,19)4(14,15)3(12,13)5(16,17)8(23,24)25;1-4-8-6(7)5(2)3/h;2,4H2,1,3H3 |
| InChIKey | RMUJCLFVMDEWMM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.28 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|