About (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial
(9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial (PubChem CID 175445758) has the molecular formula C14H15N3S2
and a molecular weight of 289.43 g/mol. Its IUPAC name is (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial.
Molecular Properties
| Compound Name | (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial |
| PubChem CID | 175445758 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial |
| SMILES | CS(C=S)(NN)c1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H15N3S2/c1-19(9-18,17-15)13-8-4-6-11-10-5-2-3-7-12(10)16-14(11)13/h2-9,16-17H,15H2,1H3 |
| InChIKey | JFHHBRMVNCIRMB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial?
The IUPAC name of (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial (CID 175445758) is (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial.
What is the SMILES notation for (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial?
The canonical SMILES for (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial is CS(C=S)(NN)c1cccc2c1[nH]c1ccccc12.
What is the InChIKey of (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial?
The InChIKey is JFHHBRMVNCIRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3S2/c1-19(9-18,17-15)13-8-4-6-11-10-5-2-3-7-12(10)16-14(11)13/h2-9,16-17H,15H2,1H3.
What are the key properties of (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial?
(9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial has a molecular weight of 289.43 g/mol, XLogP of 3.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9H-carbazol-1-yl-hydrazinyl-methyl-λ4-sulfanyl)methanethial is sourced from PubChem (CID 175445758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).