C8H19NO3P+ — CID 175453056
[2-[hydroxy(2-hydroxypropyl)phosphanyl]-2-oxoethyl]-trimethylazanium (PubChem CID 175453056) has the molecular formula C8H19NO3P+ and a molecular weight of 208.22 g/mol. Its IUPAC name is [2-[hydroxy(2-hydroxypropyl)phosphanyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[hydroxy(2-hydroxypropyl)phosphanyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 175453056 |
| Molecular Formula | C8H19NO3P+ |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [2-[hydroxy(2-hydroxypropyl)phosphanyl]-2-oxoethyl]-trimethylazanium |
| SMILES | CC(O)CP(O)C(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C8H19NO3P/c1-7(10)6-13(12)8(11)5-9(2,3)4/h7,10,12H,5-6H2,1-4H3/q+1 |
| InChIKey | FUEWSNBYDVJXGF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|