C11H21NO3P+ — CID 175350831
[2-[hydroxy-(4-methyl-3-oxopent-4-en-2-yl)phosphanyl]-2-oxoethyl]-trimethylazanium (PubChem CID 175350831) has the molecular formula C11H21NO3P+ and a molecular weight of 246.27 g/mol. Its IUPAC name is [2-[hydroxy-(4-methyl-3-oxopent-4-en-2-yl)phosphanyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[hydroxy-(4-methyl-3-oxopent-4-en-2-yl)phosphanyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 175350831 |
| Molecular Formula | C11H21NO3P+ |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [2-[hydroxy-(4-methyl-3-oxopent-4-en-2-yl)phosphanyl]-2-oxoethyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)C(C)P(O)C(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO3P/c1-8(2)11(14)9(3)16(15)10(13)7-12(4,5)6/h9,15H,1,7H2,2-6H3/q+1 |
| InChIKey | LGCVXARCBMUAOP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|